C17H20N4O2 — CID 159423102
5-methoxy-6-[(4-pentylphenyl)methyl]-[1,2,5]oxadiazolo[3,4-b]pyrazine (PubChem CID 159423102) has the molecular formula C17H20N4O2 and a molecular weight of 312.37 g/mol. Its IUPAC name is 5-methoxy-6-[(4-pentylphenyl)methyl]-[1,2,5]oxadiazolo[3,4-b]pyrazine.
| Compound Name | 5-methoxy-6-[(4-pentylphenyl)methyl]-[1,2,5]oxadiazolo[3,4-b]pyrazine |
|---|---|
| PubChem CID | 159423102 |
| Molecular Formula | C17H20N4O2 |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.16 |
| IUPAC Name | 5-methoxy-6-[(4-pentylphenyl)methyl]-[1,2,5]oxadiazolo[3,4-b]pyrazine |
| SMILES | CCCCCc1ccc(Cc2nc3nonc3nc2OC)cc1 |
| InChI | InChI=1S/C17H20N4O2/c1-3-4-5-6-12-7-9-13(10-8-12)11-14-17(22-2)19-16-15(18-14)20-23-21-16/h7-10H,3-6,11H2,1-2H3 |
| InChIKey | YFBRKMAPTJNVJL-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 73.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|