C16H18N4O2 — CID 157453171
5-butoxy-6-[(4-methylphenyl)methyl]-[1,2,5]oxadiazolo[3,4-b]pyrazine (PubChem CID 157453171) has the molecular formula C16H18N4O2 and a molecular weight of 298.35 g/mol. Its IUPAC name is 5-butoxy-6-[(4-methylphenyl)methyl]-[1,2,5]oxadiazolo[3,4-b]pyrazine.
| Compound Name | 5-butoxy-6-[(4-methylphenyl)methyl]-[1,2,5]oxadiazolo[3,4-b]pyrazine |
|---|---|
| PubChem CID | 157453171 |
| Molecular Formula | C16H18N4O2 |
| Molecular Weight | 298.35 g/mol |
| Exact Mass | 298.14 |
| IUPAC Name | 5-butoxy-6-[(4-methylphenyl)methyl]-[1,2,5]oxadiazolo[3,4-b]pyrazine |
| SMILES | CCCCOc1nc2nonc2nc1Cc1ccc(C)cc1 |
| InChI | InChI=1S/C16H18N4O2/c1-3-4-9-21-16-13(10-12-7-5-11(2)6-8-12)17-14-15(18-16)20-22-19-14/h5-8H,3-4,9-10H2,1-2H3 |
| InChIKey | BPYFHWTZBWAOGN-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 73.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.35 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|