C14H14FN5O2 — CID 146200481
5-butoxy-N-(2-fluorophenyl)-[1,2,5]oxadiazolo[3,4-b]pyrazin-6-amine (PubChem CID 146200481) has the molecular formula C14H14FN5O2 and a molecular weight of 303.30 g/mol. Its IUPAC name is 5-butoxy-N-(2-fluorophenyl)-[1,2,5]oxadiazolo[3,4-b]pyrazin-6-amine.
| Compound Name | 5-butoxy-N-(2-fluorophenyl)-[1,2,5]oxadiazolo[3,4-b]pyrazin-6-amine |
|---|---|
| PubChem CID | 146200481 |
| Molecular Formula | C14H14FN5O2 |
| Molecular Weight | 303.30 g/mol |
| Exact Mass | 303.11 |
| IUPAC Name | 5-butoxy-N-(2-fluorophenyl)-[1,2,5]oxadiazolo[3,4-b]pyrazin-6-amine |
| SMILES | CCCCOc1nc2nonc2nc1Nc1ccccc1F |
| InChI | InChI=1S/C14H14FN5O2/c1-2-3-8-21-14-13(16-10-7-5-4-6-9(10)15)17-11-12(18-14)20-22-19-11/h4-7H,2-3,8H2,1H3,(H,16,17,19) |
| InChIKey | VTIKVPGIJZOJMT-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 85.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.30 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|