C17H17F3N4O3 — CID 157428413
6-[[4-pentyl-2-(trifluoromethoxy)phenyl]methyl]-4H-[1,2,5]oxadiazolo[3,4-b]pyrazin-5-one (PubChem CID 157428413) has the molecular formula C17H17F3N4O3 and a molecular weight of 382.34 g/mol. Its IUPAC name is 6-[[4-pentyl-2-(trifluoromethoxy)phenyl]methyl]-4H-[1,2,5]oxadiazolo[3,4-b]pyrazin-5-one.
| Compound Name | 6-[[4-pentyl-2-(trifluoromethoxy)phenyl]methyl]-4H-[1,2,5]oxadiazolo[3,4-b]pyrazin-5-one |
|---|---|
| PubChem CID | 157428413 |
| Molecular Formula | C17H17F3N4O3 |
| Molecular Weight | 382.34 g/mol |
| Exact Mass | 382.13 |
| IUPAC Name | 6-[[4-pentyl-2-(trifluoromethoxy)phenyl]methyl]-4H-[1,2,5]oxadiazolo[3,4-b]pyrazin-5-one |
| SMILES | CCCCCc1ccc(Cc2nc3nonc3[nH]c2=O)c(OC(F)(F)F)c1 |
| InChI | InChI=1S/C17H17F3N4O3/c1-2-3-4-5-10-6-7-11(13(8-10)26-17(18,19)20)9-12-16(25)22-15-14(21-12)23-27-24-15/h6-8H,2-5,9H2,1H3,(H,22,24,25) |
| InChIKey | BQFWFWXIZXBQCO-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 93.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.34 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|