About calcium 2-[(2-oxido-4-pentylphenyl)methyl]-5-pentylphenolate
calcium 2-[(2-oxido-4-pentylphenyl)methyl]-5-pentylphenolate (PubChem CID 101275827) has the molecular formula C23H30CaO2
and a molecular weight of 378.57 g/mol. Its IUPAC name is calcium 2-[(2-oxido-4-pentylphenyl)methyl]-5-pentylphenolate.
Molecular Properties
| Compound Name | calcium 2-[(2-oxido-4-pentylphenyl)methyl]-5-pentylphenolate |
| PubChem CID | 101275827 |
| Molecular Formula | C23H30CaO2 |
| Molecular Weight | 378.57 g/mol |
| Exact Mass | 378.19 |
| IUPAC Name | calcium 2-[(2-oxido-4-pentylphenyl)methyl]-5-pentylphenolate |
| SMILES | CCCCCc1ccc(Cc2ccc(CCCCC)cc2[O-])c([O-])c1.[Ca+2] |
| InChI | InChI=1S/C23H32O2.Ca/c1-3-5-7-9-18-11-13-20(22(24)15-18)17-21-14-12-19(16-23(21)25)10-8-6-4-2;/h11-16,24-25H,3-10,17H2,1-2H3;/q;+2/p-2 |
| InChIKey | NANZAMISPRWOIE-UHFFFAOYSA-L |
| XLogP | 4.51 |
| TPSA | 46.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 378.57 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze calcium 2-[(2-oxido-4-pentylphenyl)methyl]-5-pentylphenolate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of calcium 2-[(2-oxido-4-pentylphenyl)methyl]-5-pentylphenolate?
The IUPAC name of calcium 2-[(2-oxido-4-pentylphenyl)methyl]-5-pentylphenolate (CID 101275827) is calcium 2-[(2-oxido-4-pentylphenyl)methyl]-5-pentylphenolate.
What is the SMILES notation for calcium 2-[(2-oxido-4-pentylphenyl)methyl]-5-pentylphenolate?
The canonical SMILES for calcium 2-[(2-oxido-4-pentylphenyl)methyl]-5-pentylphenolate is CCCCCc1ccc(Cc2ccc(CCCCC)cc2[O-])c([O-])c1.[Ca+2].
What is the InChIKey of calcium 2-[(2-oxido-4-pentylphenyl)methyl]-5-pentylphenolate?
The InChIKey is NANZAMISPRWOIE-UHFFFAOYSA-L. The full InChI is InChI=1S/C23H32O2.Ca/c1-3-5-7-9-18-11-13-20(22(24)15-18)17-21-14-12-19(16-23(21)25)10-8-6-4-2;/h11-16,24-25H,3-10,17H2,1-2H3;/q;+2/p-2.
What are the key properties of calcium 2-[(2-oxido-4-pentylphenyl)methyl]-5-pentylphenolate?
calcium 2-[(2-oxido-4-pentylphenyl)methyl]-5-pentylphenolate has a molecular weight of 378.57 g/mol, XLogP of 4.51, 10 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for calcium 2-[(2-oxido-4-pentylphenyl)methyl]-5-pentylphenolate is sourced from PubChem (CID 101275827), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).