About 6-pentylphthalazine
6-pentylphthalazine (PubChem CID 21134765) has the molecular formula C13H16N2
and a molecular weight of 200.28 g/mol. Its IUPAC name is 6-pentylphthalazine.
Molecular Properties
| Compound Name | 6-pentylphthalazine |
| PubChem CID | 21134765 |
| Molecular Formula | C13H16N2 |
| Molecular Weight | 200.28 g/mol |
| Exact Mass | 200.13 |
| IUPAC Name | 6-pentylphthalazine |
| SMILES | CCCCCc1ccc2cnncc2c1 |
| InChI | InChI=1S/C13H16N2/c1-2-3-4-5-11-6-7-12-9-14-15-10-13(12)8-11/h6-10H,2-5H2,1H3 |
| InChIKey | HTVJAVCTTPDDBM-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.28 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 6-pentylphthalazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-pentylphthalazine?
The IUPAC name of 6-pentylphthalazine (CID 21134765) is 6-pentylphthalazine.
What is the SMILES notation for 6-pentylphthalazine?
The canonical SMILES for 6-pentylphthalazine is CCCCCc1ccc2cnncc2c1.
What is the InChIKey of 6-pentylphthalazine?
The InChIKey is HTVJAVCTTPDDBM-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16N2/c1-2-3-4-5-11-6-7-12-9-14-15-10-13(12)8-11/h6-10H,2-5H2,1H3.
What are the key properties of 6-pentylphthalazine?
6-pentylphthalazine has a molecular weight of 200.28 g/mol, XLogP of 3.36, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-pentylphthalazine is sourced from PubChem (CID 21134765), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).