About 5-dodecyl-1H-indazole
5-dodecyl-1H-indazole (PubChem CID 67799721) has the molecular formula C19H30N2
and a molecular weight of 286.46 g/mol. Its IUPAC name is 5-dodecyl-1H-indazole.
Molecular Properties
| Compound Name | 5-dodecyl-1H-indazole |
| PubChem CID | 67799721 |
| Molecular Formula | C19H30N2 |
| Molecular Weight | 286.46 g/mol |
| Exact Mass | 286.24 |
| IUPAC Name | 5-dodecyl-1H-indazole |
| SMILES | CCCCCCCCCCCCc1ccc2[nH]ncc2c1 |
| InChI | InChI=1S/C19H30N2/c1-2-3-4-5-6-7-8-9-10-11-12-17-13-14-19-18(15-17)16-20-21-19/h13-16H,2-12H2,1H3,(H,20,21) |
| InChIKey | LOOAJFPGCKYDAW-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 286.46 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-dodecyl-1H-indazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-dodecyl-1H-indazole?
The IUPAC name of 5-dodecyl-1H-indazole (CID 67799721) is 5-dodecyl-1H-indazole.
What is the SMILES notation for 5-dodecyl-1H-indazole?
The canonical SMILES for 5-dodecyl-1H-indazole is CCCCCCCCCCCCc1ccc2[nH]ncc2c1.
What is the InChIKey of 5-dodecyl-1H-indazole?
The InChIKey is LOOAJFPGCKYDAW-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H30N2/c1-2-3-4-5-6-7-8-9-10-11-12-17-13-14-19-18(15-17)16-20-21-19/h13-16H,2-12H2,1H3,(H,20,21).
What are the key properties of 5-dodecyl-1H-indazole?
5-dodecyl-1H-indazole has a molecular weight of 286.46 g/mol, XLogP of 6.03, 11 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-dodecyl-1H-indazole is sourced from PubChem (CID 67799721), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).