C18H22N6O — CID 154962027
2-(1H-indazol-5-ylmethylamino)-4-methanimidoyl-5-pentyl-1H-pyrimidin-6-one (PubChem CID 154962027) has the molecular formula C18H22N6O and a molecular weight of 338.41 g/mol. Its IUPAC name is 2-(1H-indazol-5-ylmethylamino)-4-methanimidoyl-5-pentyl-1H-pyrimidin-6-one.
| Compound Name | 2-(1H-indazol-5-ylmethylamino)-4-methanimidoyl-5-pentyl-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 154962027 |
| Molecular Formula | C18H22N6O |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.19 |
| IUPAC Name | 2-(1H-indazol-5-ylmethylamino)-4-methanimidoyl-5-pentyl-1H-pyrimidin-6-one |
| SMILES | [H]/N=C/c1nc(NCc2ccc3[nH]ncc3c2)[nH]c(=O)c1CCCCC |
| InChI | InChI=1S/C18H22N6O/c1-2-3-4-5-14-16(9-19)22-18(23-17(14)25)20-10-12-6-7-15-13(8-12)11-21-24-15/h6-9,11,19H,2-5,10H2,1H3,(H,21,24)(H2,20,22,23,25)/b19-9+ |
| InChIKey | AHFRMCNZLUYVMN-DJKKODMXSA-N |
| XLogP | 2.99 |
| TPSA | 110.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|