C21H25Cl2N5O2 — CID 154962168
2-[(3,4-dichlorophenyl)methylamino]-4-methanimidoyl-5-[(Z)-7-methoxy-6-(methylideneamino)hept-6-enyl]-1H-pyrimidin-6-one (PubChem CID 154962168) has the molecular formula C21H25Cl2N5O2 and a molecular weight of 450.37 g/mol. Its IUPAC name is 2-[(3,4-dichlorophenyl)methylamino]-4-methanimidoyl-5-[(Z)-7-methoxy-6-(methylideneamino)hept-6-enyl]-1H-pyrimidin-6-one.
| Compound Name | 2-[(3,4-dichlorophenyl)methylamino]-4-methanimidoyl-5-[(Z)-7-methoxy-6-(methylideneamino)hept-6-enyl]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 154962168 |
| Molecular Formula | C21H25Cl2N5O2 |
| Molecular Weight | 450.37 g/mol |
| Exact Mass | 449.14 |
| IUPAC Name | 2-[(3,4-dichlorophenyl)methylamino]-4-methanimidoyl-5-[(Z)-7-methoxy-6-(methylideneamino)hept-6-enyl]-1H-pyrimidin-6-one |
| SMILES | [H]/N=C/c1nc(NCc2ccc(Cl)c(Cl)c2)[nH]c(=O)c1CCCCC/C(=C/OC)N=C |
| InChI | InChI=1S/C21H25Cl2N5O2/c1-25-15(13-30-2)6-4-3-5-7-16-19(11-24)27-21(28-20(16)29)26-12-14-8-9-17(22)18(23)10-14/h8-11,13,24H,1,3-7,12H2,2H3,(H2,26,27,28,29)/b15-13-,24-11+ |
| InChIKey | LICSLHFWOZTHDY-VJJNUWJGSA-N |
| XLogP | 4.98 |
| TPSA | 103.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.37 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|