C21H21Cl2N7O — CID 154961910
2-[(3,4-dichlorophenyl)methylamino]-4-methanimidoyl-5-[(1-pyridin-4-ylpyrrolidin-3-yl)amino]-1H-pyrimidin-6-one (PubChem CID 154961910) has the molecular formula C21H21Cl2N7O and a molecular weight of 458.35 g/mol. Its IUPAC name is 2-[(3,4-dichlorophenyl)methylamino]-4-methanimidoyl-5-[(1-pyridin-4-ylpyrrolidin-3-yl)amino]-1H-pyrimidin-6-one.
| Compound Name | 2-[(3,4-dichlorophenyl)methylamino]-4-methanimidoyl-5-[(1-pyridin-4-ylpyrrolidin-3-yl)amino]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 154961910 |
| Molecular Formula | C21H21Cl2N7O |
| Molecular Weight | 458.35 g/mol |
| Exact Mass | 457.12 |
| IUPAC Name | 2-[(3,4-dichlorophenyl)methylamino]-4-methanimidoyl-5-[(1-pyridin-4-ylpyrrolidin-3-yl)amino]-1H-pyrimidin-6-one |
| SMILES | [H]/N=C\c1nc(NCc2ccc(Cl)c(Cl)c2)[nH]c(=O)c1NC1CCN(c2ccncc2)C1 |
| InChI | InChI=1S/C21H21Cl2N7O/c22-16-2-1-13(9-17(16)23)11-26-21-28-18(10-24)19(20(31)29-21)27-14-5-8-30(12-14)15-3-6-25-7-4-15/h1-4,6-7,9-10,14,24,27H,5,8,11-12H2,(H2,26,28,29,31)/b24-10- |
| InChIKey | QJCZKRHQKORRPD-VROXFSQNSA-N |
| XLogP | 3.77 |
| TPSA | 109.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.35 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|