C22H23Cl2N7O — CID 164730731
2-[(3,4-dichlorophenyl)methylamino]-4-methanimidoyl-5-[(1-pyridin-2-ylpiperidin-4-yl)amino]-1H-pyrimidin-6-one (PubChem CID 164730731) has the molecular formula C22H23Cl2N7O and a molecular weight of 472.38 g/mol. Its IUPAC name is 2-[(3,4-dichlorophenyl)methylamino]-4-methanimidoyl-5-[(1-pyridin-2-ylpiperidin-4-yl)amino]-1H-pyrimidin-6-one.
| Compound Name | 2-[(3,4-dichlorophenyl)methylamino]-4-methanimidoyl-5-[(1-pyridin-2-ylpiperidin-4-yl)amino]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 164730731 |
| Molecular Formula | C22H23Cl2N7O |
| Molecular Weight | 472.38 g/mol |
| Exact Mass | 471.13 |
| IUPAC Name | 2-[(3,4-dichlorophenyl)methylamino]-4-methanimidoyl-5-[(1-pyridin-2-ylpiperidin-4-yl)amino]-1H-pyrimidin-6-one |
| SMILES | [H]/N=C/c1nc(NCc2ccc(Cl)c(Cl)c2)[nH]c(=O)c1NC1CCN(c2ccccn2)CC1 |
| InChI | InChI=1S/C22H23Cl2N7O/c23-16-5-4-14(11-17(16)24)13-27-22-29-18(12-25)20(21(32)30-22)28-15-6-9-31(10-7-15)19-3-1-2-8-26-19/h1-5,8,11-12,15,25,28H,6-7,9-10,13H2,(H2,27,29,30,32)/b25-12+ |
| InChIKey | BUJHDRFTOSEOMH-BRJLIKDPSA-N |
| XLogP | 4.16 |
| TPSA | 109.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.38 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|