C20H27Cl2N5O5 — CID 154961896
2-[(3,4-dichlorophenyl)methylamino]-5-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethylamino]-4-methanimidoyl-1H-pyrimidin-6-one (PubChem CID 154961896) has the molecular formula C20H27Cl2N5O5 and a molecular weight of 488.37 g/mol. Its IUPAC name is 2-[(3,4-dichlorophenyl)methylamino]-5-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethylamino]-4-methanimidoyl-1H-pyrimidin-6-one.
| Compound Name | 2-[(3,4-dichlorophenyl)methylamino]-5-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethylamino]-4-methanimidoyl-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 154961896 |
| Molecular Formula | C20H27Cl2N5O5 |
| Molecular Weight | 488.37 g/mol |
| Exact Mass | 487.14 |
| IUPAC Name | 2-[(3,4-dichlorophenyl)methylamino]-5-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethylamino]-4-methanimidoyl-1H-pyrimidin-6-one |
| SMILES | [H]/N=C/c1nc(NCc2ccc(Cl)c(Cl)c2)[nH]c(=O)c1NCCOCCOCCOCCO |
| InChI | InChI=1S/C20H27Cl2N5O5/c21-15-2-1-14(11-16(15)22)13-25-20-26-17(12-23)18(19(29)27-20)24-3-5-30-7-9-32-10-8-31-6-4-28/h1-2,11-12,23-24,28H,3-10,13H2,(H2,25,26,27,29)/b23-12+ |
| InChIKey | YIQSLEAUUTULJZ-FSJBWODESA-N |
| XLogP | 2.14 |
| TPSA | 141.58 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.37 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|