C16H17Cl2N5O3 — CID 151107940
5-[(3,4-dichlorophenyl)methylamino]-1-(2-methoxyethoxymethyl)-6H-pyrazolo[4,5-d]pyrimidin-7-one (PubChem CID 151107940) has the molecular formula C16H17Cl2N5O3 and a molecular weight of 398.25 g/mol. Its IUPAC name is 5-[(3,4-dichlorophenyl)methylamino]-1-(2-methoxyethoxymethyl)-6H-pyrazolo[4,5-d]pyrimidin-7-one.
| Compound Name | 5-[(3,4-dichlorophenyl)methylamino]-1-(2-methoxyethoxymethyl)-6H-pyrazolo[4,5-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 151107940 |
| Molecular Formula | C16H17Cl2N5O3 |
| Molecular Weight | 398.25 g/mol |
| Exact Mass | 397.07 |
| IUPAC Name | 5-[(3,4-dichlorophenyl)methylamino]-1-(2-methoxyethoxymethyl)-6H-pyrazolo[4,5-d]pyrimidin-7-one |
| SMILES | COCCOCn1ncc2nc(NCc3ccc(Cl)c(Cl)c3)[nH]c(=O)c21 |
| InChI | InChI=1S/C16H17Cl2N5O3/c1-25-4-5-26-9-23-14-13(8-20-23)21-16(22-15(14)24)19-7-10-2-3-11(17)12(18)6-10/h2-3,6,8H,4-5,7,9H2,1H3,(H2,19,21,22,24) |
| InChIKey | MPMSYVBXCQGDNG-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 94.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.25 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|