C17H19Cl2N5O4S — CID 154606873
5-[(3,4-dichlorophenyl)methylamino]-1-[2-(2-methylsulfonylethoxy)ethyl]-6H-pyrazolo[4,5-d]pyrimidin-7-one (PubChem CID 154606873) has the molecular formula C17H19Cl2N5O4S and a molecular weight of 460.34 g/mol. Its IUPAC name is 5-[(3,4-dichlorophenyl)methylamino]-1-[2-(2-methylsulfonylethoxy)ethyl]-6H-pyrazolo[4,5-d]pyrimidin-7-one.
| Compound Name | 5-[(3,4-dichlorophenyl)methylamino]-1-[2-(2-methylsulfonylethoxy)ethyl]-6H-pyrazolo[4,5-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 154606873 |
| Molecular Formula | C17H19Cl2N5O4S |
| Molecular Weight | 460.34 g/mol |
| Exact Mass | 459.05 |
| IUPAC Name | 5-[(3,4-dichlorophenyl)methylamino]-1-[2-(2-methylsulfonylethoxy)ethyl]-6H-pyrazolo[4,5-d]pyrimidin-7-one |
| SMILES | CS(=O)(=O)CCOCCn1ncc2nc(NCc3ccc(Cl)c(Cl)c3)[nH]c(=O)c21 |
| InChI | InChI=1S/C17H19Cl2N5O4S/c1-29(26,27)7-6-28-5-4-24-15-14(10-21-24)22-17(23-16(15)25)20-9-11-2-3-12(18)13(19)8-11/h2-3,8,10H,4-7,9H2,1H3,(H2,20,22,23,25) |
| InChIKey | XMQOJSHKQIEWIK-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 118.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.34 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|