C22H27Cl2N5O4 — CID 154606630
5-[(3,4-dichlorophenyl)methylamino]-1-[2-[3-(oxan-2-yloxy)propoxy]ethyl]-6H-pyrazolo[4,5-d]pyrimidin-7-one (PubChem CID 154606630) has the molecular formula C22H27Cl2N5O4 and a molecular weight of 496.40 g/mol. Its IUPAC name is 5-[(3,4-dichlorophenyl)methylamino]-1-[2-[3-(oxan-2-yloxy)propoxy]ethyl]-6H-pyrazolo[4,5-d]pyrimidin-7-one.
| Compound Name | 5-[(3,4-dichlorophenyl)methylamino]-1-[2-[3-(oxan-2-yloxy)propoxy]ethyl]-6H-pyrazolo[4,5-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 154606630 |
| Molecular Formula | C22H27Cl2N5O4 |
| Molecular Weight | 496.40 g/mol |
| Exact Mass | 495.14 |
| IUPAC Name | 5-[(3,4-dichlorophenyl)methylamino]-1-[2-[3-(oxan-2-yloxy)propoxy]ethyl]-6H-pyrazolo[4,5-d]pyrimidin-7-one |
| SMILES | O=c1[nH]c(NCc2ccc(Cl)c(Cl)c2)nc2cnn(CCOCCCOC3CCCCO3)c12 |
| InChI | InChI=1S/C22H27Cl2N5O4/c23-16-6-5-15(12-17(16)24)13-25-22-27-18-14-26-29(20(18)21(30)28-22)7-11-31-8-3-10-33-19-4-1-2-9-32-19/h5-6,12,14,19H,1-4,7-11,13H2,(H2,25,27,28,30) |
| InChIKey | UVQWVIRSOIRODO-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 103.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.40 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|