C14H13Cl2IN6O — CID 155014392
5-[(3,4-dichlorophenyl)methylamino]-1-[2-(iodoamino)ethyl]-6H-pyrazolo[4,5-d]pyrimidin-7-one (PubChem CID 155014392) has the molecular formula C14H13Cl2IN6O and a molecular weight of 479.11 g/mol. Its IUPAC name is 5-[(3,4-dichlorophenyl)methylamino]-1-[2-(iodoamino)ethyl]-6H-pyrazolo[4,5-d]pyrimidin-7-one.
| Compound Name | 5-[(3,4-dichlorophenyl)methylamino]-1-[2-(iodoamino)ethyl]-6H-pyrazolo[4,5-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 155014392 |
| Molecular Formula | C14H13Cl2IN6O |
| Molecular Weight | 479.11 g/mol |
| Exact Mass | 477.96 |
| IUPAC Name | 5-[(3,4-dichlorophenyl)methylamino]-1-[2-(iodoamino)ethyl]-6H-pyrazolo[4,5-d]pyrimidin-7-one |
| SMILES | O=c1[nH]c(NCc2ccc(Cl)c(Cl)c2)nc2cnn(CCNI)c12 |
| InChI | InChI=1S/C14H13Cl2IN6O/c15-9-2-1-8(5-10(9)16)6-18-14-21-11-7-20-23(4-3-19-17)12(11)13(24)22-14/h1-2,5,7,19H,3-4,6H2,(H2,18,21,22,24) |
| InChIKey | QZRUVAJABWGPEJ-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 87.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.11 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|