C15H17Cl3N8O — CID 154606717
2-[2-[5-[(3,4-dichlorophenyl)methylamino]-7-oxo-6H-pyrazolo[4,5-d]pyrimidin-1-yl]ethyl]guanidine;hydrochloride (PubChem CID 154606717) has the molecular formula C15H17Cl3N8O and a molecular weight of 431.72 g/mol. Its IUPAC name is 2-[2-[5-[(3,4-dichlorophenyl)methylamino]-7-oxo-6H-pyrazolo[4,5-d]pyrimidin-1-yl]ethyl]guanidine;hydrochloride.
| Compound Name | 2-[2-[5-[(3,4-dichlorophenyl)methylamino]-7-oxo-6H-pyrazolo[4,5-d]pyrimidin-1-yl]ethyl]guanidine;hydrochloride |
|---|---|
| PubChem CID | 154606717 |
| Molecular Formula | C15H17Cl3N8O |
| Molecular Weight | 431.72 g/mol |
| Exact Mass | 430.06 |
| IUPAC Name | 2-[2-[5-[(3,4-dichlorophenyl)methylamino]-7-oxo-6H-pyrazolo[4,5-d]pyrimidin-1-yl]ethyl]guanidine;hydrochloride |
| SMILES | Cl.NC(N)=NCCn1ncc2nc(NCc3ccc(Cl)c(Cl)c3)[nH]c(=O)c21 |
| InChI | InChI=1S/C15H16Cl2N8O.ClH/c16-9-2-1-8(5-10(9)17)6-21-15-23-11-7-22-25(4-3-20-14(18)19)12(11)13(26)24-15;/h1-2,5,7H,3-4,6H2,(H4,18,19,20)(H2,21,23,24,26);1H |
| InChIKey | SETIFOOBUYCFIK-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 140.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.72 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|