C17H17Cl2N5O4 — CID 154606635
methyl 2-[2-[5-[(3,4-dichlorophenyl)methylamino]-7-oxo-6H-pyrazolo[4,5-d]pyrimidin-1-yl]ethoxy]acetate (PubChem CID 154606635) has the molecular formula C17H17Cl2N5O4 and a molecular weight of 426.26 g/mol. Its IUPAC name is methyl 2-[2-[5-[(3,4-dichlorophenyl)methylamino]-7-oxo-6H-pyrazolo[4,5-d]pyrimidin-1-yl]ethoxy]acetate.
| Compound Name | methyl 2-[2-[5-[(3,4-dichlorophenyl)methylamino]-7-oxo-6H-pyrazolo[4,5-d]pyrimidin-1-yl]ethoxy]acetate |
|---|---|
| PubChem CID | 154606635 |
| Molecular Formula | C17H17Cl2N5O4 |
| Molecular Weight | 426.26 g/mol |
| Exact Mass | 425.07 |
| IUPAC Name | methyl 2-[2-[5-[(3,4-dichlorophenyl)methylamino]-7-oxo-6H-pyrazolo[4,5-d]pyrimidin-1-yl]ethoxy]acetate |
| SMILES | COC(=O)COCCn1ncc2nc(NCc3ccc(Cl)c(Cl)c3)[nH]c(=O)c21 |
| InChI | InChI=1S/C17H17Cl2N5O4/c1-27-14(25)9-28-5-4-24-15-13(8-21-24)22-17(23-16(15)26)20-7-10-2-3-11(18)12(19)6-10/h2-3,6,8H,4-5,7,9H2,1H3,(H2,20,22,23,26) |
| InChIKey | RWPMFSVAYUEOOX-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 111.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.26 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|