C16H19Cl3N6O2 — CID 154606593
1-[2-(2-aminoethoxy)ethyl]-5-[(3,4-dichlorophenyl)methylamino]-6H-pyrazolo[4,5-d]pyrimidin-7-one;hydrochloride (PubChem CID 154606593) has the molecular formula C16H19Cl3N6O2 and a molecular weight of 433.73 g/mol. Its IUPAC name is 1-[2-(2-aminoethoxy)ethyl]-5-[(3,4-dichlorophenyl)methylamino]-6H-pyrazolo[4,5-d]pyrimidin-7-one;hydrochloride.
| Compound Name | 1-[2-(2-aminoethoxy)ethyl]-5-[(3,4-dichlorophenyl)methylamino]-6H-pyrazolo[4,5-d]pyrimidin-7-one;hydrochloride |
|---|---|
| PubChem CID | 154606593 |
| Molecular Formula | C16H19Cl3N6O2 |
| Molecular Weight | 433.73 g/mol |
| Exact Mass | 432.06 |
| IUPAC Name | 1-[2-(2-aminoethoxy)ethyl]-5-[(3,4-dichlorophenyl)methylamino]-6H-pyrazolo[4,5-d]pyrimidin-7-one;hydrochloride |
| SMILES | Cl.NCCOCCn1ncc2nc(NCc3ccc(Cl)c(Cl)c3)[nH]c(=O)c21 |
| InChI | InChI=1S/C16H18Cl2N6O2.ClH/c17-11-2-1-10(7-12(11)18)8-20-16-22-13-9-21-24(4-6-26-5-3-19)14(13)15(25)23-16;/h1-2,7,9H,3-6,8,19H2,(H2,20,22,23,25);1H |
| InChIKey | QNSITNHXJGGVPW-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 110.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.73 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|