C17H17Cl2N5O2 — CID 154941817
5-[(3,4-dichlorophenyl)methylamino]-1-(4-methoxybut-2-enyl)-6H-pyrazolo[4,5-d]pyrimidin-7-one (PubChem CID 154941817) has the molecular formula C17H17Cl2N5O2 and a molecular weight of 394.26 g/mol. Its IUPAC name is 5-[(3,4-dichlorophenyl)methylamino]-1-(4-methoxybut-2-enyl)-6H-pyrazolo[4,5-d]pyrimidin-7-one.
| Compound Name | 5-[(3,4-dichlorophenyl)methylamino]-1-(4-methoxybut-2-enyl)-6H-pyrazolo[4,5-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 154941817 |
| Molecular Formula | C17H17Cl2N5O2 |
| Molecular Weight | 394.26 g/mol |
| Exact Mass | 393.08 |
| IUPAC Name | 5-[(3,4-dichlorophenyl)methylamino]-1-(4-methoxybut-2-enyl)-6H-pyrazolo[4,5-d]pyrimidin-7-one |
| SMILES | COCC=CCn1ncc2nc(NCc3ccc(Cl)c(Cl)c3)[nH]c(=O)c21 |
| InChI | InChI=1S/C17H17Cl2N5O2/c1-26-7-3-2-6-24-15-14(10-21-24)22-17(23-16(15)25)20-9-11-4-5-12(18)13(19)8-11/h2-5,8,10H,6-7,9H2,1H3,(H2,20,22,23,25) |
| InChIKey | UWZRKBCWHDHYMD-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 84.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.26 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|