C28H40Cl2N4O2 — CID 154962187
2-[(3,4-dichlorophenyl)methylamino]-4-methanimidoyl-5-[4-[4-(3-methoxypropyl)cyclooctyl]butyl]-1H-pyrimidin-6-one (PubChem CID 154962187) has the molecular formula C28H40Cl2N4O2 and a molecular weight of 535.56 g/mol. Its IUPAC name is 2-[(3,4-dichlorophenyl)methylamino]-4-methanimidoyl-5-[4-[4-(3-methoxypropyl)cyclooctyl]butyl]-1H-pyrimidin-6-one.
| Compound Name | 2-[(3,4-dichlorophenyl)methylamino]-4-methanimidoyl-5-[4-[4-(3-methoxypropyl)cyclooctyl]butyl]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 154962187 |
| Molecular Formula | C28H40Cl2N4O2 |
| Molecular Weight | 535.56 g/mol |
| Exact Mass | 534.25 |
| IUPAC Name | 2-[(3,4-dichlorophenyl)methylamino]-4-methanimidoyl-5-[4-[4-(3-methoxypropyl)cyclooctyl]butyl]-1H-pyrimidin-6-one |
| SMILES | [H]/N=C/c1nc(NCc2ccc(Cl)c(Cl)c2)[nH]c(=O)c1CCCCC1CCCCC(CCCOC)CC1 |
| InChI | InChI=1S/C28H40Cl2N4O2/c1-36-16-6-10-21-8-3-2-7-20(12-13-21)9-4-5-11-23-26(18-31)33-28(34-27(23)35)32-19-22-14-15-24(29)25(30)17-22/h14-15,17-18,20-21,31H,2-13,16,19H2,1H3,(H2,32,33,34,35)/b31-18+ |
| InChIKey | FGTOOPNLUDAMMW-FDAWAROLSA-N |
| XLogP | 7.41 |
| TPSA | 90.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.56 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|