C18H24Cl2N6O2 — CID 154962245
2-[(3,4-dichlorophenyl)methylamino]-5-[2-[2-(dimethylamino)ethoxy]ethylamino]-4-methanimidoyl-1H-pyrimidin-6-one (PubChem CID 154962245) has the molecular formula C18H24Cl2N6O2 and a molecular weight of 427.34 g/mol. Its IUPAC name is 2-[(3,4-dichlorophenyl)methylamino]-5-[2-[2-(dimethylamino)ethoxy]ethylamino]-4-methanimidoyl-1H-pyrimidin-6-one.
| Compound Name | 2-[(3,4-dichlorophenyl)methylamino]-5-[2-[2-(dimethylamino)ethoxy]ethylamino]-4-methanimidoyl-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 154962245 |
| Molecular Formula | C18H24Cl2N6O2 |
| Molecular Weight | 427.34 g/mol |
| Exact Mass | 426.13 |
| IUPAC Name | 2-[(3,4-dichlorophenyl)methylamino]-5-[2-[2-(dimethylamino)ethoxy]ethylamino]-4-methanimidoyl-1H-pyrimidin-6-one |
| SMILES | [H]/N=C/c1nc(NCc2ccc(Cl)c(Cl)c2)[nH]c(=O)c1NCCOCCN(C)C |
| InChI | InChI=1S/C18H24Cl2N6O2/c1-26(2)6-8-28-7-5-22-16-15(10-21)24-18(25-17(16)27)23-11-12-3-4-13(19)14(20)9-12/h3-4,9-10,21-22H,5-8,11H2,1-2H3,(H2,23,24,25,27)/b21-10+ |
| InChIKey | VHJUVTFEFBABNX-UFFVCSGVSA-N |
| XLogP | 2.68 |
| TPSA | 106.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.34 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|