C19H24Cl2N4O3 — CID 154962200
2-[(3,4-dichlorophenyl)methylamino]-5-[6-hydroxy-5-(hydroxymethyl)hexyl]-4-methanimidoyl-1H-pyrimidin-6-one (PubChem CID 154962200) has the molecular formula C19H24Cl2N4O3 and a molecular weight of 427.33 g/mol. Its IUPAC name is 2-[(3,4-dichlorophenyl)methylamino]-5-[6-hydroxy-5-(hydroxymethyl)hexyl]-4-methanimidoyl-1H-pyrimidin-6-one.
| Compound Name | 2-[(3,4-dichlorophenyl)methylamino]-5-[6-hydroxy-5-(hydroxymethyl)hexyl]-4-methanimidoyl-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 154962200 |
| Molecular Formula | C19H24Cl2N4O3 |
| Molecular Weight | 427.33 g/mol |
| Exact Mass | 426.12 |
| IUPAC Name | 2-[(3,4-dichlorophenyl)methylamino]-5-[6-hydroxy-5-(hydroxymethyl)hexyl]-4-methanimidoyl-1H-pyrimidin-6-one |
| SMILES | [H]/N=C/c1nc(NCc2ccc(Cl)c(Cl)c2)[nH]c(=O)c1CCCCC(CO)CO |
| InChI | InChI=1S/C19H24Cl2N4O3/c20-15-6-5-12(7-16(15)21)9-23-19-24-17(8-22)14(18(28)25-19)4-2-1-3-13(10-26)11-27/h5-8,13,22,26-27H,1-4,9-11H2,(H2,23,24,25,28)/b22-8+ |
| InChIKey | IJTDTRXKFFKRGD-GZIVZEMBSA-N |
| XLogP | 3.00 |
| TPSA | 122.09 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.33 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|