C20H20Cl2N6O3 — CID 154962207
2-[(3,4-dichlorophenyl)methylamino]-5-[2-[[6-(hydroxymethyl)-3-pyridinyl]oxy]ethylamino]-4-methanimidoyl-1H-pyrimidin-6-one (PubChem CID 154962207) has the molecular formula C20H20Cl2N6O3 and a molecular weight of 463.33 g/mol. Its IUPAC name is 2-[(3,4-dichlorophenyl)methylamino]-5-[2-[[6-(hydroxymethyl)-3-pyridinyl]oxy]ethylamino]-4-methanimidoyl-1H-pyrimidin-6-one.
| Compound Name | 2-[(3,4-dichlorophenyl)methylamino]-5-[2-[[6-(hydroxymethyl)-3-pyridinyl]oxy]ethylamino]-4-methanimidoyl-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 154962207 |
| Molecular Formula | C20H20Cl2N6O3 |
| Molecular Weight | 463.33 g/mol |
| Exact Mass | 462.10 |
| IUPAC Name | 2-[(3,4-dichlorophenyl)methylamino]-5-[2-[[6-(hydroxymethyl)-3-pyridinyl]oxy]ethylamino]-4-methanimidoyl-1H-pyrimidin-6-one |
| SMILES | [H]/N=C/c1nc(NCc2ccc(Cl)c(Cl)c2)[nH]c(=O)c1NCCOc1ccc(CO)nc1 |
| InChI | InChI=1S/C20H20Cl2N6O3/c21-15-4-1-12(7-16(15)22)9-26-20-27-17(8-23)18(19(30)28-20)24-5-6-31-14-3-2-13(11-29)25-10-14/h1-4,7-8,10,23-24,29H,5-6,9,11H2,(H2,26,27,28,30)/b23-8+ |
| InChIKey | OBILFOVOWDITKD-LIMNOBDPSA-N |
| XLogP | 3.06 |
| TPSA | 136.01 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.33 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|