About 3-[(7-amino-2,1,3-benzoxadiazol-4-yl)oxy]propan-1-ol
3-[(7-amino-2,1,3-benzoxadiazol-4-yl)oxy]propan-1-ol (PubChem CID 43518767) has the molecular formula C9H11N3O3
and a molecular weight of 209.21 g/mol. Its IUPAC name is 3-[(7-amino-2,1,3-benzoxadiazol-4-yl)oxy]propan-1-ol.
Molecular Properties
| Compound Name | 3-[(7-amino-2,1,3-benzoxadiazol-4-yl)oxy]propan-1-ol |
| PubChem CID | 43518767 |
| Molecular Formula | C9H11N3O3 |
| Molecular Weight | 209.21 g/mol |
| Exact Mass | 209.08 |
| IUPAC Name | 3-[(7-amino-2,1,3-benzoxadiazol-4-yl)oxy]propan-1-ol |
| SMILES | Nc1ccc(OCCCO)c2nonc12 |
| InChI | InChI=1S/C9H11N3O3/c10-6-2-3-7(14-5-1-4-13)9-8(6)11-15-12-9/h2-3,13H,1,4-5,10H2 |
| InChIKey | YSTYQBJPVDHTRT-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 94.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.21 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3-[(7-amino-2,1,3-benzoxadiazol-4-yl)oxy]propan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(7-amino-2,1,3-benzoxadiazol-4-yl)oxy]propan-1-ol?
The IUPAC name of 3-[(7-amino-2,1,3-benzoxadiazol-4-yl)oxy]propan-1-ol (CID 43518767) is 3-[(7-amino-2,1,3-benzoxadiazol-4-yl)oxy]propan-1-ol.
What is the SMILES notation for 3-[(7-amino-2,1,3-benzoxadiazol-4-yl)oxy]propan-1-ol?
The canonical SMILES for 3-[(7-amino-2,1,3-benzoxadiazol-4-yl)oxy]propan-1-ol is Nc1ccc(OCCCO)c2nonc12.
What is the InChIKey of 3-[(7-amino-2,1,3-benzoxadiazol-4-yl)oxy]propan-1-ol?
The InChIKey is YSTYQBJPVDHTRT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11N3O3/c10-6-2-3-7(14-5-1-4-13)9-8(6)11-15-12-9/h2-3,13H,1,4-5,10H2.
What are the key properties of 3-[(7-amino-2,1,3-benzoxadiazol-4-yl)oxy]propan-1-ol?
3-[(7-amino-2,1,3-benzoxadiazol-4-yl)oxy]propan-1-ol has a molecular weight of 209.21 g/mol, XLogP of 0.57, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(7-amino-2,1,3-benzoxadiazol-4-yl)oxy]propan-1-ol is sourced from PubChem (CID 43518767), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).