C13H10BrN3O2 — CID 82828278
4-[(4-bromophenyl)methoxy]-2,1,3-benzoxadiazol-7-amine (PubChem CID 82828278) has the molecular formula C13H10BrN3O2 and a molecular weight of 320.15 g/mol. Its IUPAC name is 4-[(4-bromophenyl)methoxy]-2,1,3-benzoxadiazol-7-amine.
| Compound Name | 4-[(4-bromophenyl)methoxy]-2,1,3-benzoxadiazol-7-amine |
|---|---|
| PubChem CID | 82828278 |
| Molecular Formula | C13H10BrN3O2 |
| Molecular Weight | 320.15 g/mol |
| Exact Mass | 319.00 |
| IUPAC Name | 4-[(4-bromophenyl)methoxy]-2,1,3-benzoxadiazol-7-amine |
| SMILES | Nc1ccc(OCc2ccc(Br)cc2)c2nonc12 |
| InChI | InChI=1S/C13H10BrN3O2/c14-9-3-1-8(2-4-9)7-18-11-6-5-10(15)12-13(11)17-19-16-12/h1-6H,7,15H2 |
| InChIKey | WWMGQHIMFVPZAC-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 74.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.15 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|