C13H9Br3O — CID 59330950
1,4-dibromo-2-[(4-bromophenyl)methoxy]benzene (PubChem CID 59330950) has the molecular formula C13H9Br3O and a molecular weight of 420.93 g/mol. Its IUPAC name is 1,4-dibromo-2-[(4-bromophenyl)methoxy]benzene.
| Compound Name | 1,4-dibromo-2-[(4-bromophenyl)methoxy]benzene |
|---|---|
| PubChem CID | 59330950 |
| Molecular Formula | C13H9Br3O |
| Molecular Weight | 420.93 g/mol |
| Exact Mass | 417.82 |
| IUPAC Name | 1,4-dibromo-2-[(4-bromophenyl)methoxy]benzene |
| SMILES | Brc1ccc(COc2cc(Br)ccc2Br)cc1 |
| InChI | InChI=1S/C13H9Br3O/c14-10-3-1-9(2-4-10)8-17-13-7-11(15)5-6-12(13)16/h1-7H,8H2 |
| InChIKey | BDGURNSNZZZOJG-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.93 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |