C9H11N3O3 — CID 43518708
4-(2-methoxyethoxy)-2,1,3-benzoxadiazol-7-amine (PubChem CID 43518708) has the molecular formula C9H11N3O3 and a molecular weight of 209.20 g/mol. Its IUPAC name is 4-(2-methoxyethoxy)-2,1,3-benzoxadiazol-7-amine.
| Compound Name | 4-(2-methoxyethoxy)-2,1,3-benzoxadiazol-7-amine |
|---|---|
| PubChem CID | 43518708 |
| Molecular Formula | C9H11N3O3 |
| Molecular Weight | 209.20 g/mol |
| Exact Mass | 209.08 |
| IUPAC Name | 4-(2-methoxyethoxy)-2,1,3-benzoxadiazol-7-amine |
| SMILES | COCCOc1ccc(N)c2nonc12 |
| InChI | InChI=1S/C9H11N3O3/c1-13-4-5-14-7-3-2-6(10)8-9(7)12-15-11-8/h2-3H,4-5,10H2,1H3 |
| InChIKey | QBRSDUGSSKTWLI-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 83.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.20 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|