C15H19N3O2 — CID 174469442
2-(2-aminophenyl)-4-(2-methoxyethoxy)benzene-1,3-diamine (PubChem CID 174469442) has the molecular formula C15H19N3O2 and a molecular weight of 273.34 g/mol. Its IUPAC name is 2-(2-aminophenyl)-4-(2-methoxyethoxy)benzene-1,3-diamine.
| Compound Name | 2-(2-aminophenyl)-4-(2-methoxyethoxy)benzene-1,3-diamine |
|---|---|
| PubChem CID | 174469442 |
| Molecular Formula | C15H19N3O2 |
| Molecular Weight | 273.34 g/mol |
| Exact Mass | 273.15 |
| IUPAC Name | 2-(2-aminophenyl)-4-(2-methoxyethoxy)benzene-1,3-diamine |
| SMILES | COCCOc1ccc(N)c(-c2ccccc2N)c1N |
| InChI | InChI=1S/C15H19N3O2/c1-19-8-9-20-13-7-6-12(17)14(15(13)18)10-4-2-3-5-11(10)16/h2-7H,8-9,16-18H2,1H3 |
| InChIKey | VDROZQJWFRCJKQ-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 96.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.34 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|