C9H10N4O4 — CID 62348820
3-[(7-nitro-2,1,3-benzoxadiazol-4-yl)oxy]propan-1-amine (PubChem CID 62348820) has the molecular formula C9H10N4O4 and a molecular weight of 238.20 g/mol. Its IUPAC name is 3-[(7-nitro-2,1,3-benzoxadiazol-4-yl)oxy]propan-1-amine.
| Compound Name | 3-[(7-nitro-2,1,3-benzoxadiazol-4-yl)oxy]propan-1-amine |
|---|---|
| PubChem CID | 62348820 |
| Molecular Formula | C9H10N4O4 |
| Molecular Weight | 238.20 g/mol |
| Exact Mass | 238.07 |
| IUPAC Name | 3-[(7-nitro-2,1,3-benzoxadiazol-4-yl)oxy]propan-1-amine |
| SMILES | NCCCOc1ccc([N+](=O)[O-])c2nonc12 |
| InChI | InChI=1S/C9H10N4O4/c10-4-1-5-16-7-3-2-6(13(14)15)8-9(7)12-17-11-8/h2-3H,1,4-5,10H2 |
| InChIKey | IMDBBXLGIFMTJB-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 117.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.20 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|