C13H16N4O4 — CID 62358034
7-nitro-4-(2-piperidin-3-ylethoxy)-2,1,3-benzoxadiazole (PubChem CID 62358034) has the molecular formula C13H16N4O4 and a molecular weight of 292.29 g/mol. Its IUPAC name is 7-nitro-4-(2-piperidin-3-ylethoxy)-2,1,3-benzoxadiazole.
| Compound Name | 7-nitro-4-(2-piperidin-3-ylethoxy)-2,1,3-benzoxadiazole |
|---|---|
| PubChem CID | 62358034 |
| Molecular Formula | C13H16N4O4 |
| Molecular Weight | 292.29 g/mol |
| Exact Mass | 292.12 |
| IUPAC Name | 7-nitro-4-(2-piperidin-3-ylethoxy)-2,1,3-benzoxadiazole |
| SMILES | O=[N+]([O-])c1ccc(OCCC2CCCNC2)c2nonc12 |
| InChI | InChI=1S/C13H16N4O4/c18-17(19)10-3-4-11(13-12(10)15-21-16-13)20-7-5-9-2-1-6-14-8-9/h3-4,9,14H,1-2,5-8H2 |
| InChIKey | KBYZLEAGSNZVOT-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 103.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.29 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|