C13H9N3O5 — CID 79870729
[3-[(7-nitro-2,1,3-benzoxadiazol-4-yl)oxy]phenyl]methanol (PubChem CID 79870729) has the molecular formula C13H9N3O5 and a molecular weight of 287.23 g/mol. Its IUPAC name is [3-[(7-nitro-2,1,3-benzoxadiazol-4-yl)oxy]phenyl]methanol.
| Compound Name | [3-[(7-nitro-2,1,3-benzoxadiazol-4-yl)oxy]phenyl]methanol |
|---|---|
| PubChem CID | 79870729 |
| Molecular Formula | C13H9N3O5 |
| Molecular Weight | 287.23 g/mol |
| Exact Mass | 287.05 |
| IUPAC Name | [3-[(7-nitro-2,1,3-benzoxadiazol-4-yl)oxy]phenyl]methanol |
| SMILES | O=[N+]([O-])c1ccc(Oc2cccc(CO)c2)c2nonc12 |
| InChI | InChI=1S/C13H9N3O5/c17-7-8-2-1-3-9(6-8)20-11-5-4-10(16(18)19)12-13(11)15-21-14-12/h1-6,17H,7H2 |
| InChIKey | LZBBOAJVERQINK-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 111.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.23 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|