C22H17N7O5 — CID 177371577
5-[[4-[[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]methyl]triazol-1-yl]methyl]-2-phenoxyphenol (PubChem CID 177371577) has the molecular formula C22H17N7O5 and a molecular weight of 459.42 g/mol. Its IUPAC name is 5-[[4-[[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]methyl]triazol-1-yl]methyl]-2-phenoxyphenol.
| Compound Name | 5-[[4-[[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]methyl]triazol-1-yl]methyl]-2-phenoxyphenol |
|---|---|
| PubChem CID | 177371577 |
| Molecular Formula | C22H17N7O5 |
| Molecular Weight | 459.42 g/mol |
| Exact Mass | 459.13 |
| IUPAC Name | 5-[[4-[[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]methyl]triazol-1-yl]methyl]-2-phenoxyphenol |
| SMILES | O=[N+]([O-])c1ccc(NCc2cn(Cc3ccc(Oc4ccccc4)c(O)c3)nn2)c2nonc12 |
| InChI | InChI=1S/C22H17N7O5/c30-19-10-14(6-9-20(19)33-16-4-2-1-3-5-16)12-28-13-15(24-27-28)11-23-17-7-8-18(29(31)32)22-21(17)25-34-26-22/h1-10,13,23,30H,11-12H2 |
| InChIKey | ZNMODSHQFNOZTM-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 154.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.42 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|