C20H27N7O6 — CID 166907876
(4S,6S)-6-[[4-[6-[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]hexyl]triazol-1-yl]methyl]oxane-2,4-diol (PubChem CID 166907876) has the molecular formula C20H27N7O6 and a molecular weight of 461.48 g/mol. Its IUPAC name is (4S,6S)-6-[[4-[6-[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]hexyl]triazol-1-yl]methyl]oxane-2,4-diol.
| Compound Name | (4S,6S)-6-[[4-[6-[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]hexyl]triazol-1-yl]methyl]oxane-2,4-diol |
|---|---|
| PubChem CID | 166907876 |
| Molecular Formula | C20H27N7O6 |
| Molecular Weight | 461.48 g/mol |
| Exact Mass | 461.20 |
| IUPAC Name | (4S,6S)-6-[[4-[6-[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]hexyl]triazol-1-yl]methyl]oxane-2,4-diol |
| SMILES | O=[N+]([O-])c1ccc(NCCCCCCc2cn(C[C@@H]3C[C@H](O)CC(O)O3)nn2)c2nonc12 |
| InChI | InChI=1S/C20H27N7O6/c28-14-9-15(32-18(29)10-14)12-26-11-13(22-25-26)5-3-1-2-4-8-21-16-6-7-17(27(30)31)20-19(16)23-33-24-20/h6-7,11,14-15,18,21,28-29H,1-5,8-10,12H2/t14-,15-,18?/m0/s1 |
| InChIKey | ZHCNTXCKLPEOAO-INHRHCAVSA-N |
| XLogP | 1.80 |
| TPSA | 174.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.48 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|