C28H38N10O4 — CID 23787166
6-N-butyl-2-N-[2-(4-methoxyphenyl)ethyl]-4-N-[6-[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]hexyl]-1,3,5-triazine-2,4,6-triamine (PubChem CID 23787166) has the molecular formula C28H38N10O4 and a molecular weight of 578.68 g/mol. Its IUPAC name is 6-N-butyl-2-N-[2-(4-methoxyphenyl)ethyl]-4-N-[6-[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]hexyl]-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 6-N-butyl-2-N-[2-(4-methoxyphenyl)ethyl]-4-N-[6-[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]hexyl]-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 23787166 |
| Molecular Formula | C28H38N10O4 |
| Molecular Weight | 578.68 g/mol |
| Exact Mass | 578.31 |
| IUPAC Name | 6-N-butyl-2-N-[2-(4-methoxyphenyl)ethyl]-4-N-[6-[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]hexyl]-1,3,5-triazine-2,4,6-triamine |
| SMILES | CCCCNc1nc(NCCCCCCNc2ccc([N+](=O)[O-])c3nonc23)nc(NCCc2ccc(OC)cc2)n1 |
| InChI | InChI=1S/C28H38N10O4/c1-3-4-16-30-26-33-27(35-28(34-26)32-19-15-20-9-11-21(41-2)12-10-20)31-18-8-6-5-7-17-29-22-13-14-23(38(39)40)25-24(22)36-42-37-25/h9-14,29H,3-8,15-19H2,1-2H3,(H3,30,31,32,33,34,35) |
| InChIKey | ZVNUBIOFBCGXPD-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 178.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.68 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|