C24H36FN5O5 — CID 102012511
N-[(E,2R)-4-fluoro-1-hydroxydodec-3-en-2-yl]-6-[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]hexanamide (PubChem CID 102012511) has the molecular formula C24H36FN5O5 and a molecular weight of 493.58 g/mol. Its IUPAC name is N-[(E,2R)-4-fluoro-1-hydroxydodec-3-en-2-yl]-6-[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]hexanamide.
| Compound Name | N-[(E,2R)-4-fluoro-1-hydroxydodec-3-en-2-yl]-6-[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]hexanamide |
|---|---|
| PubChem CID | 102012511 |
| Molecular Formula | C24H36FN5O5 |
| Molecular Weight | 493.58 g/mol |
| Exact Mass | 493.27 |
| IUPAC Name | N-[(E,2R)-4-fluoro-1-hydroxydodec-3-en-2-yl]-6-[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]hexanamide |
| SMILES | CCCCCCCC/C(F)=C\[C@H](CO)NC(=O)CCCCCNc1ccc([N+](=O)[O-])c2nonc12 |
| InChI | InChI=1S/C24H36FN5O5/c1-2-3-4-5-6-8-11-18(25)16-19(17-31)27-22(32)12-9-7-10-15-26-20-13-14-21(30(33)34)24-23(20)28-35-29-24/h13-14,16,19,26,31H,2-12,15,17H2,1H3,(H,27,32)/b18-16+/t19-/m1/s1 |
| InChIKey | MGTFBCIVMOJIQN-WNZNBFKUSA-N |
| XLogP | 5.18 |
| TPSA | 143.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.58 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|