C24H37N5O6 — CID 102012507
N-[(E,2S,3S)-1,3-dihydroxydodec-4-en-2-yl]-6-[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]hexanamide (PubChem CID 102012507) has the molecular formula C24H37N5O6 and a molecular weight of 491.59 g/mol. Its IUPAC name is N-[(E,2S,3S)-1,3-dihydroxydodec-4-en-2-yl]-6-[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]hexanamide.
| Compound Name | N-[(E,2S,3S)-1,3-dihydroxydodec-4-en-2-yl]-6-[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]hexanamide |
|---|---|
| PubChem CID | 102012507 |
| Molecular Formula | C24H37N5O6 |
| Molecular Weight | 491.59 g/mol |
| Exact Mass | 491.27 |
| IUPAC Name | N-[(E,2S,3S)-1,3-dihydroxydodec-4-en-2-yl]-6-[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]hexanamide |
| SMILES | CCCCCCC/C=C/[C@H](O)[C@H](CO)NC(=O)CCCCCNc1ccc([N+](=O)[O-])c2nonc12 |
| InChI | InChI=1S/C24H37N5O6/c1-2-3-4-5-6-7-9-12-21(31)19(17-30)26-22(32)13-10-8-11-16-25-18-14-15-20(29(33)34)24-23(18)27-35-28-24/h9,12,14-15,19,21,25,30-31H,2-8,10-11,13,16-17H2,1H3,(H,26,32)/b12-9+/t19-,21-/m0/s1 |
| InChIKey | BBYZKYVZWHVZEG-HZXPXBNSSA-N |
| XLogP | 3.86 |
| TPSA | 163.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.59 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|