C10H9N7O3 — CID 79531329
N-[(5-amino-1H-pyrazol-4-yl)methyl]-4-nitro-2,1,3-benzoxadiazol-7-amine (PubChem CID 79531329) has the molecular formula C10H9N7O3 and a molecular weight of 275.23 g/mol. Its IUPAC name is N-[(5-amino-1H-pyrazol-4-yl)methyl]-4-nitro-2,1,3-benzoxadiazol-7-amine.
| Compound Name | N-[(5-amino-1H-pyrazol-4-yl)methyl]-4-nitro-2,1,3-benzoxadiazol-7-amine |
|---|---|
| PubChem CID | 79531329 |
| Molecular Formula | C10H9N7O3 |
| Molecular Weight | 275.23 g/mol |
| Exact Mass | 275.08 |
| IUPAC Name | N-[(5-amino-1H-pyrazol-4-yl)methyl]-4-nitro-2,1,3-benzoxadiazol-7-amine |
| SMILES | Nc1[nH]ncc1CNc1ccc([N+](=O)[O-])c2nonc12 |
| InChI | InChI=1S/C10H9N7O3/c11-10-5(4-13-14-10)3-12-6-1-2-7(17(18)19)9-8(6)15-20-16-9/h1-2,4,12H,3H2,(H3,11,13,14) |
| InChIKey | CIFDTZNSMGQNAY-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 148.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.23 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|