C10H9FIN5O2 — CID 79529878
4-[(5-fluoro-4-iodo-2-nitroanilino)methyl]-1H-pyrazol-5-amine (PubChem CID 79529878) has the molecular formula C10H9FIN5O2 and a molecular weight of 377.12 g/mol. Its IUPAC name is 4-[(5-fluoro-4-iodo-2-nitroanilino)methyl]-1H-pyrazol-5-amine.
| Compound Name | 4-[(5-fluoro-4-iodo-2-nitroanilino)methyl]-1H-pyrazol-5-amine |
|---|---|
| PubChem CID | 79529878 |
| Molecular Formula | C10H9FIN5O2 |
| Molecular Weight | 377.12 g/mol |
| Exact Mass | 376.98 |
| IUPAC Name | 4-[(5-fluoro-4-iodo-2-nitroanilino)methyl]-1H-pyrazol-5-amine |
| SMILES | Nc1[nH]ncc1CNc1cc(F)c(I)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C10H9FIN5O2/c11-6-1-8(9(17(18)19)2-7(6)12)14-3-5-4-15-16-10(5)13/h1-2,4,14H,3H2,(H3,13,15,16) |
| InChIKey | OPVIEEZBRQTFMB-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 109.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.12 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|