C11H10F3N5O2 — CID 79530445
4-[[4-nitro-3-(trifluoromethyl)anilino]methyl]-1H-pyrazol-5-amine (PubChem CID 79530445) has the molecular formula C11H10F3N5O2 and a molecular weight of 301.23 g/mol. Its IUPAC name is 4-[[4-nitro-3-(trifluoromethyl)anilino]methyl]-1H-pyrazol-5-amine.
| Compound Name | 4-[[4-nitro-3-(trifluoromethyl)anilino]methyl]-1H-pyrazol-5-amine |
|---|---|
| PubChem CID | 79530445 |
| Molecular Formula | C11H10F3N5O2 |
| Molecular Weight | 301.23 g/mol |
| Exact Mass | 301.08 |
| IUPAC Name | 4-[[4-nitro-3-(trifluoromethyl)anilino]methyl]-1H-pyrazol-5-amine |
| SMILES | Nc1[nH]ncc1CNc1ccc([N+](=O)[O-])c(C(F)(F)F)c1 |
| InChI | InChI=1S/C11H10F3N5O2/c12-11(13,14)8-3-7(1-2-9(8)19(20)21)16-4-6-5-17-18-10(6)15/h1-3,5,16H,4H2,(H3,15,17,18) |
| InChIKey | CBUGWQUEEDOZGB-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 109.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.23 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|