C10H10N6O4 — CID 79530294
4-[(2,4-dinitroanilino)methyl]-1H-pyrazol-5-amine (PubChem CID 79530294) has the molecular formula C10H10N6O4 and a molecular weight of 278.23 g/mol. Its IUPAC name is 4-[(2,4-dinitroanilino)methyl]-1H-pyrazol-5-amine.
| Compound Name | 4-[(2,4-dinitroanilino)methyl]-1H-pyrazol-5-amine |
|---|---|
| PubChem CID | 79530294 |
| Molecular Formula | C10H10N6O4 |
| Molecular Weight | 278.23 g/mol |
| Exact Mass | 278.08 |
| IUPAC Name | 4-[(2,4-dinitroanilino)methyl]-1H-pyrazol-5-amine |
| SMILES | Nc1[nH]ncc1CNc1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C10H10N6O4/c11-10-6(5-13-14-10)4-12-8-2-1-7(15(17)18)3-9(8)16(19)20/h1-3,5,12H,4H2,(H3,11,13,14) |
| InChIKey | WXXAJIOOFWBKSX-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 153.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.23 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|