C11H13N5O2 — CID 79530019
4-[(4-methyl-3-nitroanilino)methyl]-1H-pyrazol-5-amine (PubChem CID 79530019) has the molecular formula C11H13N5O2 and a molecular weight of 247.26 g/mol. Its IUPAC name is 4-[(4-methyl-3-nitroanilino)methyl]-1H-pyrazol-5-amine.
| Compound Name | 4-[(4-methyl-3-nitroanilino)methyl]-1H-pyrazol-5-amine |
|---|---|
| PubChem CID | 79530019 |
| Molecular Formula | C11H13N5O2 |
| Molecular Weight | 247.26 g/mol |
| Exact Mass | 247.11 |
| IUPAC Name | 4-[(4-methyl-3-nitroanilino)methyl]-1H-pyrazol-5-amine |
| SMILES | Cc1ccc(NCc2cn[nH]c2N)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C11H13N5O2/c1-7-2-3-9(4-10(7)16(17)18)13-5-8-6-14-15-11(8)12/h2-4,6,13H,5H2,1H3,(H3,12,14,15) |
| InChIKey | GQAZVOAQPDWAHZ-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 109.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.26 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|