C16H14N6O7 — CID 72725312
N-[[1-[(4-methoxy-3-nitrophenyl)methyl]triazol-4-yl]methyl]-5-nitrofuran-2-carboxamide (PubChem CID 72725312) has the molecular formula C16H14N6O7 and a molecular weight of 402.32 g/mol. Its IUPAC name is N-[[1-[(4-methoxy-3-nitrophenyl)methyl]triazol-4-yl]methyl]-5-nitrofuran-2-carboxamide.
| Compound Name | N-[[1-[(4-methoxy-3-nitrophenyl)methyl]triazol-4-yl]methyl]-5-nitrofuran-2-carboxamide |
|---|---|
| PubChem CID | 72725312 |
| Molecular Formula | C16H14N6O7 |
| Molecular Weight | 402.32 g/mol |
| Exact Mass | 402.09 |
| IUPAC Name | N-[[1-[(4-methoxy-3-nitrophenyl)methyl]triazol-4-yl]methyl]-5-nitrofuran-2-carboxamide |
| SMILES | COc1ccc(Cn2cc(CNC(=O)c3ccc([N+](=O)[O-])o3)nn2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H14N6O7/c1-28-13-3-2-10(6-12(13)21(24)25)8-20-9-11(18-19-20)7-17-16(23)14-4-5-15(29-14)22(26)27/h2-6,9H,7-8H2,1H3,(H,17,23) |
| InChIKey | GTKPUWUQOXLIMB-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 168.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.32 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|