C12H8N4O4 — CID 3128188
2-[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]phenol (PubChem CID 3128188) has the molecular formula C12H8N4O4 and a molecular weight of 272.22 g/mol. Its IUPAC name is 2-[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]phenol.
| Compound Name | 2-[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]phenol |
|---|---|
| PubChem CID | 3128188 |
| Molecular Formula | C12H8N4O4 |
| Molecular Weight | 272.22 g/mol |
| Exact Mass | 272.05 |
| IUPAC Name | 2-[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]phenol |
| SMILES | O=[N+]([O-])c1ccc(Nc2ccccc2O)c2nonc12 |
| InChI | InChI=1S/C12H8N4O4/c17-10-4-2-1-3-7(10)13-8-5-6-9(16(18)19)12-11(8)14-20-15-12/h1-6,13,17H |
| InChIKey | HHVJOCNDEBRJFJ-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 114.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.22 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|