C18H8N4O6 — CID 177445127
7-[(7-nitro-2,1,3-benzoxadiazol-4-yl)oxy]phenoxazin-3-one (PubChem CID 177445127) has the molecular formula C18H8N4O6 and a molecular weight of 376.28 g/mol. Its IUPAC name is 7-[(7-nitro-2,1,3-benzoxadiazol-4-yl)oxy]phenoxazin-3-one.
| Compound Name | 7-[(7-nitro-2,1,3-benzoxadiazol-4-yl)oxy]phenoxazin-3-one |
|---|---|
| PubChem CID | 177445127 |
| Molecular Formula | C18H8N4O6 |
| Molecular Weight | 376.28 g/mol |
| Exact Mass | 376.04 |
| IUPAC Name | 7-[(7-nitro-2,1,3-benzoxadiazol-4-yl)oxy]phenoxazin-3-one |
| SMILES | O=c1ccc2nc3ccc(Oc4ccc([N+](=O)[O-])c5nonc45)cc3oc-2c1 |
| InChI | InChI=1S/C18H8N4O6/c23-9-1-3-11-15(7-9)27-16-8-10(2-4-12(16)19-11)26-14-6-5-13(22(24)25)17-18(14)21-28-20-17/h1-8H |
| InChIKey | GUVNOCRCUQDVLA-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 134.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.28 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|