About disodium;(7-oxophenoxazin-3-yl) phosphate
disodium;(7-oxophenoxazin-3-yl) phosphate (PubChem CID 171379159) has the molecular formula C12H6NNa2O6P
and a molecular weight of 337.14 g/mol. Its IUPAC name is disodium;(7-oxophenoxazin-3-yl) phosphate.
Molecular Properties
| Compound Name | disodium;(7-oxophenoxazin-3-yl) phosphate |
| PubChem CID | 171379159 |
| Molecular Formula | C12H6NNa2O6P |
| Molecular Weight | 337.14 g/mol |
| Exact Mass | 336.97 |
| IUPAC Name | disodium;(7-oxophenoxazin-3-yl) phosphate |
| SMILES | O=c1ccc2nc3ccc(OP(=O)([O-])[O-])cc3oc-2c1.[Na+].[Na+] |
| InChI | InChI=1S/C12H8NO6P.2Na/c14-7-1-3-9-11(5-7)18-12-6-8(19-20(15,16)17)2-4-10(12)13-9;;/h1-6H,(H2,15,16,17);;/q;2*+1/p-2 |
| InChIKey | NPVMWYYSUAJPPN-UHFFFAOYSA-L |
| XLogP | -5.49 |
| TPSA | 115.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 337.14 |
| LogP ≤ 5 | -5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze disodium;(7-oxophenoxazin-3-yl) phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of disodium;(7-oxophenoxazin-3-yl) phosphate?
The IUPAC name of disodium;(7-oxophenoxazin-3-yl) phosphate (CID 171379159) is disodium;(7-oxophenoxazin-3-yl) phosphate.
What is the SMILES notation for disodium;(7-oxophenoxazin-3-yl) phosphate?
The canonical SMILES for disodium;(7-oxophenoxazin-3-yl) phosphate is O=c1ccc2nc3ccc(OP(=O)([O-])[O-])cc3oc-2c1.[Na+].[Na+].
What is the InChIKey of disodium;(7-oxophenoxazin-3-yl) phosphate?
The InChIKey is NPVMWYYSUAJPPN-UHFFFAOYSA-L. The full InChI is InChI=1S/C12H8NO6P.2Na/c14-7-1-3-9-11(5-7)18-12-6-8(19-20(15,16)17)2-4-10(12)13-9;;/h1-6H,(H2,15,16,17);;/q;2*+1/p-2.
What are the key properties of disodium;(7-oxophenoxazin-3-yl) phosphate?
disodium;(7-oxophenoxazin-3-yl) phosphate has a molecular weight of 337.14 g/mol, XLogP of -5.49, 2 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for disodium;(7-oxophenoxazin-3-yl) phosphate is sourced from PubChem (CID 171379159), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).