C12H21ClN2O4 — CID 19834651
3-[2,4-diamino-3-(3-hydroxypropoxy)phenoxy]propan-1-ol;hydrochloride (PubChem CID 19834651) has the molecular formula C12H21ClN2O4 and a molecular weight of 292.76 g/mol. Its IUPAC name is 3-[2,4-diamino-3-(3-hydroxypropoxy)phenoxy]propan-1-ol;hydrochloride.
| Compound Name | 3-[2,4-diamino-3-(3-hydroxypropoxy)phenoxy]propan-1-ol;hydrochloride |
|---|---|
| PubChem CID | 19834651 |
| Molecular Formula | C12H21ClN2O4 |
| Molecular Weight | 292.76 g/mol |
| Exact Mass | 292.12 |
| IUPAC Name | 3-[2,4-diamino-3-(3-hydroxypropoxy)phenoxy]propan-1-ol;hydrochloride |
| SMILES | Cl.Nc1ccc(OCCCO)c(N)c1OCCCO |
| InChI | InChI=1S/C12H20N2O4.ClH/c13-9-3-4-10(17-7-1-5-15)11(14)12(9)18-8-2-6-16;/h3-4,15-16H,1-2,5-8,13-14H2;1H |
| InChIKey | VPRYXKCALPMBHF-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 110.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.76 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|