C12H20N2O4 — CID 19834644
1-[2,4-diamino-3-(2-hydroxypropoxy)phenoxy]propan-2-ol (PubChem CID 19834644) has the molecular formula C12H20N2O4 and a molecular weight of 256.30 g/mol. Its IUPAC name is 1-[2,4-diamino-3-(2-hydroxypropoxy)phenoxy]propan-2-ol.
| Compound Name | 1-[2,4-diamino-3-(2-hydroxypropoxy)phenoxy]propan-2-ol |
|---|---|
| PubChem CID | 19834644 |
| Molecular Formula | C12H20N2O4 |
| Molecular Weight | 256.30 g/mol |
| Exact Mass | 256.14 |
| IUPAC Name | 1-[2,4-diamino-3-(2-hydroxypropoxy)phenoxy]propan-2-ol |
| SMILES | CC(O)COc1ccc(N)c(OCC(C)O)c1N |
| InChI | InChI=1S/C12H20N2O4/c1-7(15)5-17-10-4-3-9(13)12(11(10)14)18-6-8(2)16/h3-4,7-8,15-16H,5-6,13-14H2,1-2H3 |
| InChIKey | MGDVSGDJLANNQI-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 110.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.30 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|