About (3,4-dichlorophenyl) nitrite
(3,4-dichlorophenyl) nitrite (PubChem CID 174629361) has the molecular formula C6H3Cl2NO2
and a molecular weight of 192.00 g/mol. Its IUPAC name is (3,4-dichlorophenyl) nitrite.
Molecular Properties
| Compound Name | (3,4-dichlorophenyl) nitrite |
| PubChem CID | 174629361 |
| Molecular Formula | C6H3Cl2NO2 |
| Molecular Weight | 192.00 g/mol |
| Exact Mass | 190.95 |
| IUPAC Name | (3,4-dichlorophenyl) nitrite |
| SMILES | O=NOc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C6H3Cl2NO2/c7-5-2-1-4(11-9-10)3-6(5)8/h1-3H |
| InChIKey | SCOFQEOIPNMQEC-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.00 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (3,4-dichlorophenyl) nitrite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3,4-dichlorophenyl) nitrite?
The IUPAC name of (3,4-dichlorophenyl) nitrite (CID 174629361) is (3,4-dichlorophenyl) nitrite.
What is the SMILES notation for (3,4-dichlorophenyl) nitrite?
The canonical SMILES for (3,4-dichlorophenyl) nitrite is O=NOc1ccc(Cl)c(Cl)c1.
What is the InChIKey of (3,4-dichlorophenyl) nitrite?
The InChIKey is SCOFQEOIPNMQEC-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H3Cl2NO2/c7-5-2-1-4(11-9-10)3-6(5)8/h1-3H.
What are the key properties of (3,4-dichlorophenyl) nitrite?
(3,4-dichlorophenyl) nitrite has a molecular weight of 192.00 g/mol, XLogP of 3.05, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3,4-dichlorophenyl) nitrite is sourced from PubChem (CID 174629361), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).