C20H20ClN3O2 — CID 163931755
2-chloro-4-[1-(3-ethylpyridine-2-carbonyl)piperidin-4-yl]oxybenzonitrile (PubChem CID 163931755) has the molecular formula C20H20ClN3O2 and a molecular weight of 369.85 g/mol. Its IUPAC name is 2-chloro-4-[1-(3-ethylpyridine-2-carbonyl)piperidin-4-yl]oxybenzonitrile.
| Compound Name | 2-chloro-4-[1-(3-ethylpyridine-2-carbonyl)piperidin-4-yl]oxybenzonitrile |
|---|---|
| PubChem CID | 163931755 |
| Molecular Formula | C20H20ClN3O2 |
| Molecular Weight | 369.85 g/mol |
| Exact Mass | 369.12 |
| IUPAC Name | 2-chloro-4-[1-(3-ethylpyridine-2-carbonyl)piperidin-4-yl]oxybenzonitrile |
| SMILES | CCc1cccnc1C(=O)N1CCC(Oc2ccc(C#N)c(Cl)c2)CC1 |
| InChI | InChI=1S/C20H20ClN3O2/c1-2-14-4-3-9-23-19(14)20(25)24-10-7-16(8-11-24)26-17-6-5-15(13-22)18(21)12-17/h3-6,9,12,16H,2,7-8,10-11H2,1H3 |
| InChIKey | RJFUQNQRSMGMPE-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 66.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.85 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |